C8H8ClFN2O — CID 162677805
2-(4-chloro-2-fluorophenyl)acetohydrazide (PubChem CID 162677805) has the molecular formula C8H8ClFN2O and a molecular weight of 202.62 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)acetohydrazide.
| Compound Name | 2-(4-chloro-2-fluorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 162677805 |
| Molecular Formula | C8H8ClFN2O |
| Molecular Weight | 202.62 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)acetohydrazide |
| SMILES | NNC(=O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C8H8ClFN2O/c9-6-2-1-5(7(10)4-6)3-8(13)12-11/h1-2,4H,3,11H2,(H,12,13) |
| InChIKey | VWGICVYTJQCIKM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.62 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|