C20H15ClF3N3O2 — CID 178143871
2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-2,5-difluorophenyl]acetohydrazide (PubChem CID 178143871) has the molecular formula C20H15ClF3N3O2 and a molecular weight of 421.81 g/mol. Its IUPAC name is 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-2,5-difluorophenyl]acetohydrazide.
| Compound Name | 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-2,5-difluorophenyl]acetohydrazide |
|---|---|
| PubChem CID | 178143871 |
| Molecular Formula | C20H15ClF3N3O2 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-2,5-difluorophenyl]acetohydrazide |
| SMILES | NNC(=O)Cc1cc(F)c(-c2cccc(OCc3ccc(Cl)cc3F)n2)cc1F |
| InChI | InChI=1S/C20H15ClF3N3O2/c21-13-5-4-11(15(22)8-13)10-29-20-3-1-2-18(26-20)14-9-16(23)12(6-17(14)24)7-19(28)27-25/h1-6,8-9H,7,10,25H2,(H,27,28) |
| InChIKey | VIJWFJIMQNFDAK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|