C21H23ClFNO3 — CID 155190470
methyl 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]cyclohexyl]acetate (PubChem CID 155190470) has the molecular formula C21H23ClFNO3 and a molecular weight of 391.87 g/mol. Its IUPAC name is methyl 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]cyclohexyl]acetate.
| Compound Name | methyl 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 155190470 |
| Molecular Formula | C21H23ClFNO3 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | methyl 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]cyclohexyl]acetate |
| SMILES | COC(=O)CC1CCC(c2cccc(OCc3ccc(Cl)cc3F)n2)CC1 |
| InChI | InChI=1S/C21H23ClFNO3/c1-26-21(25)11-14-5-7-15(8-6-14)19-3-2-4-20(24-19)27-13-16-9-10-17(22)12-18(16)23/h2-4,9-10,12,14-15H,5-8,11,13H2,1H3 |
| InChIKey | HSXNYMSCKRKNFR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |