C20H23BFN3O3 — CID 174096666
CID 174096666 (PubChem CID 174096666) has the molecular formula C20H23BFN3O3 and a molecular weight of 383.23 g/mol.
| Compound Name | CID 174096666 |
|---|---|
| PubChem CID | 174096666 |
| Molecular Formula | C20H23BFN3O3 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(c2cccc(OCc3ccc(C(=O)N(C)OC)cc3F)n2)CC1 |
| InChI | InChI=1S/C20H23BFN3O3/c1-24(27-2)20(26)15-6-7-16(17(22)12-15)13-28-19-5-3-4-18(23-19)14-8-10-25(21)11-9-14/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | BBIVHZPMEBLXNK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|