C25H26FN3O — CID 167016332
2-[[2-fluoro-4-(1-pyridin-3-ylethenyl)phenyl]methoxy]-6-(1-methylpiperidin-4-yl)pyridine (PubChem CID 167016332) has the molecular formula C25H26FN3O and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(1-pyridin-3-ylethenyl)phenyl]methoxy]-6-(1-methylpiperidin-4-yl)pyridine.
| Compound Name | 2-[[2-fluoro-4-(1-pyridin-3-ylethenyl)phenyl]methoxy]-6-(1-methylpiperidin-4-yl)pyridine |
|---|---|
| PubChem CID | 167016332 |
| Molecular Formula | C25H26FN3O |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[[2-fluoro-4-(1-pyridin-3-ylethenyl)phenyl]methoxy]-6-(1-methylpiperidin-4-yl)pyridine |
| SMILES | C=C(c1cccnc1)c1ccc(COc2cccc(C3CCN(C)CC3)n2)c(F)c1 |
| InChI | InChI=1S/C25H26FN3O/c1-18(21-5-4-12-27-16-21)20-8-9-22(23(26)15-20)17-30-25-7-3-6-24(28-25)19-10-13-29(2)14-11-19/h3-9,12,15-16,19H,1,10-11,13-14,17H2,2H3 |
| InChIKey | HERIRBRKCXVUBL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |