C19H20BFN2O3 — CID 174096941
CID 174096941 (PubChem CID 174096941) has the molecular formula C19H20BFN2O3 and a molecular weight of 354.19 g/mol.
| Compound Name | CID 174096941 |
|---|---|
| PubChem CID | 174096941 |
| Molecular Formula | C19H20BFN2O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(c2cccc(OCc3cccc(C(=O)OC)c3F)n2)CC1 |
| InChI | InChI=1S/C19H20BFN2O3/c1-25-19(24)15-5-2-4-14(18(15)21)12-26-17-7-3-6-16(22-17)13-8-10-23(20)11-9-13/h2-7,13H,8-12H2,1H3 |
| InChIKey | RBUGNUATWZWYQL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|