C10H5ClF6O — CID 114038362
1-(4-chloro-2-fluorophenyl)-3,3,4,4,4-pentafluorobutan-2-one (PubChem CID 114038362) has the molecular formula C10H5ClF6O and a molecular weight of 290.59 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3,3,4,4,4-pentafluorobutan-2-one.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3,3,4,4,4-pentafluorobutan-2-one |
|---|---|
| PubChem CID | 114038362 |
| Molecular Formula | C10H5ClF6O |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3,3,4,4,4-pentafluorobutan-2-one |
| SMILES | O=C(Cc1ccc(Cl)cc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5ClF6O/c11-6-2-1-5(7(12)4-6)3-8(18)9(13,14)10(15,16)17/h1-2,4H,3H2 |
| InChIKey | AYCFAFJJSKZYBZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|