C18H19ClFNO — CID 100626606
2-(4-chloro-2-fluorophenyl)-N-(2-methyl-1-phenylpropan-2-yl)acetamide (PubChem CID 100626606) has the molecular formula C18H19ClFNO and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-N-(2-methyl-1-phenylpropan-2-yl)acetamide.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-N-(2-methyl-1-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 100626606 |
| Molecular Formula | C18H19ClFNO |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-N-(2-methyl-1-phenylpropan-2-yl)acetamide |
| SMILES | CC(C)(Cc1ccccc1)NC(=O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H19ClFNO/c1-18(2,12-13-6-4-3-5-7-13)21-17(22)10-14-8-9-15(19)11-16(14)20/h3-9,11H,10,12H2,1-2H3,(H,21,22) |
| InChIKey | HNBGKSQNNXZSAT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |