C13H15Cl2NO3 — CID 64670662
3-[[2-(2,4-dichlorophenyl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 64670662) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3-[[2-(2,4-dichlorophenyl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-[[2-(2,4-dichlorophenyl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 64670662 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-[[2-(2,4-dichlorophenyl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3/c1-13(2,7-12(18)19)16-11(17)5-8-3-4-9(14)6-10(8)15/h3-4,6H,5,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | HJUROCKITMFOAW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |