C8H7F2NO2 — CID 23207286
(2,4-difluorophenyl)methylcarbamic acid (PubChem CID 23207286) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is (2,4-difluorophenyl)methylcarbamic acid.
| Compound Name | (2,4-difluorophenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 23207286 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (2,4-difluorophenyl)methylcarbamic acid |
| SMILES | O=C(O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C8H7F2NO2/c9-6-2-1-5(7(10)3-6)4-11-8(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | KMLNNIZIVCQBOB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |