C9H6F2N2O — CID 115172177
1-cyano-N-[(2,4-difluorophenyl)methyl]formamide (PubChem CID 115172177) has the molecular formula C9H6F2N2O and a molecular weight of 196.16 g/mol. Its IUPAC name is 1-cyano-N-[(2,4-difluorophenyl)methyl]formamide.
| Compound Name | 1-cyano-N-[(2,4-difluorophenyl)methyl]formamide |
|---|---|
| PubChem CID | 115172177 |
| Molecular Formula | C9H6F2N2O |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 1-cyano-N-[(2,4-difluorophenyl)methyl]formamide |
| SMILES | N#CC(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H6F2N2O/c10-7-2-1-6(8(11)3-7)5-13-9(14)4-12/h1-3H,5H2,(H,13,14) |
| InChIKey | HRPKUUDZWYIIHB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|