C9H8F2N2O2 — CID 115191832
N'-[(2,4-difluorophenyl)methyl]oxamide (PubChem CID 115191832) has the molecular formula C9H8F2N2O2 and a molecular weight of 214.17 g/mol. Its IUPAC name is N'-[(2,4-difluorophenyl)methyl]oxamide.
| Compound Name | N'-[(2,4-difluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 115191832 |
| Molecular Formula | C9H8F2N2O2 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N'-[(2,4-difluorophenyl)methyl]oxamide |
| SMILES | NC(=O)C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H8F2N2O2/c10-6-2-1-5(7(11)3-6)4-13-9(15)8(12)14/h1-3H,4H2,(H2,12,14)(H,13,15) |
| InChIKey | IJGMGXPCUBGFOJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|