C8H9ClF2N2S — CID 87521044
(2,4-difluorophenyl)methylthiourea;hydrochloride (PubChem CID 87521044) has the molecular formula C8H9ClF2N2S and a molecular weight of 238.69 g/mol. Its IUPAC name is (2,4-difluorophenyl)methylthiourea;hydrochloride.
| Compound Name | (2,4-difluorophenyl)methylthiourea;hydrochloride |
|---|---|
| PubChem CID | 87521044 |
| Molecular Formula | C8H9ClF2N2S |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | (2,4-difluorophenyl)methylthiourea;hydrochloride |
| SMILES | Cl.NC(=S)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C8H8F2N2S.ClH/c9-6-2-1-5(7(10)3-6)4-12-8(11)13;/h1-3H,4H2,(H3,11,12,13);1H |
| InChIKey | PBEKBQQHZOZROU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|