C7H6F3N — CID 142839769
1-(2,4-difluorophenyl)-N-fluoromethanamine (PubChem CID 142839769) has the molecular formula C7H6F3N and a molecular weight of 161.13 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-fluoromethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-fluoromethanamine |
|---|---|
| PubChem CID | 142839769 |
| Molecular Formula | C7H6F3N |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-fluoromethanamine |
| SMILES | FNCc1ccc(F)cc1F |
| InChI | InChI=1S/C7H6F3N/c8-6-2-1-5(4-11-10)7(9)3-6/h1-3,11H,4H2 |
| InChIKey | KWYWAEDANPGOTD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|