C9H10ClF2NO2S — CID 107651860
2-chloro-N-[(2,4-difluorophenyl)methyl]ethanesulfonamide (PubChem CID 107651860) has the molecular formula C9H10ClF2NO2S and a molecular weight of 269.70 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-difluorophenyl)methyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651860 |
| Molecular Formula | C9H10ClF2NO2S |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCCl)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H10ClF2NO2S/c10-3-4-16(14,15)13-6-7-1-2-8(11)5-9(7)12/h1-2,5,13H,3-4,6H2 |
| InChIKey | HBXYPIDCUZVECJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|