C11H13FN2O2S — CID 63359397
N-[(4-cyano-2-fluorophenyl)methyl]propane-1-sulfonamide (PubChem CID 63359397) has the molecular formula C11H13FN2O2S and a molecular weight of 256.30 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methyl]propane-1-sulfonamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 63359397 |
| Molecular Formula | C11H13FN2O2S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C11H13FN2O2S/c1-2-5-17(15,16)14-8-10-4-3-9(7-13)6-11(10)12/h3-4,6,14H,2,5,8H2,1H3 |
| InChIKey | UMUDJTNTCKVZLC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |