C12H13FN2O4S — CID 63359222
methyl 2-[(4-cyano-2-fluorophenyl)methylsulfamoyl]propanoate (PubChem CID 63359222) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl 2-[(4-cyano-2-fluorophenyl)methylsulfamoyl]propanoate.
| Compound Name | methyl 2-[(4-cyano-2-fluorophenyl)methylsulfamoyl]propanoate |
|---|---|
| PubChem CID | 63359222 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 2-[(4-cyano-2-fluorophenyl)methylsulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)NCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C12H13FN2O4S/c1-8(12(16)19-2)20(17,18)15-7-10-4-3-9(6-14)5-11(10)13/h3-5,8,15H,7H2,1-2H3 |
| InChIKey | JKUQIIGPINWKSS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |