C17H23FN2O — CID 63359559
N-[(4-cyano-2-fluorophenyl)methyl]-3,5,5-trimethylhexanamide (PubChem CID 63359559) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 63359559 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCc1ccc(C#N)cc1F)CC(C)(C)C |
| InChI | InChI=1S/C17H23FN2O/c1-12(9-17(2,3)4)7-16(21)20-11-14-6-5-13(10-19)8-15(14)18/h5-6,8,12H,7,9,11H2,1-4H3,(H,20,21) |
| InChIKey | OXDGKIACMLFIAD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |