C13H14FNO2S — CID 96503504
methyl (3S)-3-[(4-cyano-2-fluorophenyl)methylsulfanyl]butanoate (PubChem CID 96503504) has the molecular formula C13H14FNO2S and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl (3S)-3-[(4-cyano-2-fluorophenyl)methylsulfanyl]butanoate.
| Compound Name | methyl (3S)-3-[(4-cyano-2-fluorophenyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 96503504 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | methyl (3S)-3-[(4-cyano-2-fluorophenyl)methylsulfanyl]butanoate |
| SMILES | COC(=O)C[C@H](C)SCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H14FNO2S/c1-9(5-13(16)17-2)18-8-11-4-3-10(7-15)6-12(11)14/h3-4,6,9H,5,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | KETYLKXKDFHLRF-VIFPVBQESA-N |
| XLogP | 2.88 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |