C11H13Cl2NO2S — CID 106993407
methyl 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]butanoate (PubChem CID 106993407) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is methyl 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]butanoate.
| Compound Name | methyl 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 106993407 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | methyl 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]butanoate |
| SMILES | COC(=O)CC(C)SCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H13Cl2NO2S/c1-7(5-10(15)16-2)17-6-8-3-4-9(12)14-11(8)13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | XASDSFQUYUNCDT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|