C11H13Cl2NO — CID 155376785
5-(2,6-dichloro-3-pyridinyl)-4-methylpentan-2-one (PubChem CID 155376785) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 5-(2,6-dichloro-3-pyridinyl)-4-methylpentan-2-one.
| Compound Name | 5-(2,6-dichloro-3-pyridinyl)-4-methylpentan-2-one |
|---|---|
| PubChem CID | 155376785 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-(2,6-dichloro-3-pyridinyl)-4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c1-7(5-8(2)15)6-9-3-4-10(12)14-11(9)13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | YBNYVPMGHQOJKD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|