C12H12Cl4O — CID 83925029
4-methyl-5-(2,3,5,6-tetrachlorophenyl)pentan-2-one (PubChem CID 83925029) has the molecular formula C12H12Cl4O and a molecular weight of 314.04 g/mol. Its IUPAC name is 4-methyl-5-(2,3,5,6-tetrachlorophenyl)pentan-2-one.
| Compound Name | 4-methyl-5-(2,3,5,6-tetrachlorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 83925029 |
| Molecular Formula | C12H12Cl4O |
| Molecular Weight | 314.04 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 4-methyl-5-(2,3,5,6-tetrachlorophenyl)pentan-2-one |
| SMILES | CC(=O)CC(C)Cc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl4O/c1-6(3-7(2)17)4-8-11(15)9(13)5-10(14)12(8)16/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZENIXVIXAAWSQW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.04 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|