C14H19BrO — CID 83921892
5-(2-bromo-4,5-dimethylphenyl)-4-methylpentan-2-one (PubChem CID 83921892) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 5-(2-bromo-4,5-dimethylphenyl)-4-methylpentan-2-one.
| Compound Name | 5-(2-bromo-4,5-dimethylphenyl)-4-methylpentan-2-one |
|---|---|
| PubChem CID | 83921892 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(2-bromo-4,5-dimethylphenyl)-4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)Cc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C14H19BrO/c1-9(5-12(4)16)6-13-7-10(2)11(3)8-14(13)15/h7-9H,5-6H2,1-4H3 |
| InChIKey | GVWVHZIRXUIPNB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |