C13H15BrO2 — CID 66480813
1-(4-bromo-3-methylphenyl)-2-methylpentane-1,4-dione (PubChem CID 66480813) has the molecular formula C13H15BrO2 and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-2-methylpentane-1,4-dione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-2-methylpentane-1,4-dione |
|---|---|
| PubChem CID | 66480813 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-2-methylpentane-1,4-dione |
| SMILES | CC(=O)CC(C)C(=O)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C13H15BrO2/c1-8-7-11(4-5-12(8)14)13(16)9(2)6-10(3)15/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | RBRZZKSUDPUEDZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |