About 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid
1-(4-bromo-3-methylphenyl)ethanone;nitrous acid (PubChem CID 174888398) has the molecular formula C9H10BrNO3
and a molecular weight of 260.09 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid.
Molecular Properties
| Compound Name | 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid |
| PubChem CID | 174888398 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid |
| SMILES | CC(=O)c1ccc(Br)c(C)c1.O=NO |
| InChI | InChI=1S/C9H9BrO.HNO2/c1-6-5-8(7(2)11)3-4-9(6)10;2-1-3/h3-5H,1-2H3;(H,2,3) |
| InChIKey | DTMYTWBOKLXIBB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid?
The IUPAC name of 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid (CID 174888398) is 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid.
What is the SMILES notation for 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid?
The canonical SMILES for 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid is CC(=O)c1ccc(Br)c(C)c1.O=NO.
What is the InChIKey of 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid?
The InChIKey is DTMYTWBOKLXIBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO.HNO2/c1-6-5-8(7(2)11)3-4-9(6)10;2-1-3/h3-5H,1-2H3;(H,2,3).
What are the key properties of 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid?
1-(4-bromo-3-methylphenyl)ethanone;nitrous acid has a molecular weight of 260.09 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-3-methylphenyl)ethanone;nitrous acid is sourced from PubChem (CID 174888398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).