C16H23BrO — CID 146010754
1-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexan-1-one (PubChem CID 146010754) has the molecular formula C16H23BrO and a molecular weight of 311.26 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 146010754 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexan-1-one |
| SMILES | Cc1cc(C(=O)CC(C)CC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C16H23BrO/c1-11(10-16(3,4)5)8-15(18)13-6-7-14(17)12(2)9-13/h6-7,9,11H,8,10H2,1-5H3 |
| InChIKey | YRALEACHHVQCMN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |