C16H21NO3 — CID 43161895
6-(3,5,5-trimethylhexanoyl)-3H-1,3-benzoxazol-2-one (PubChem CID 43161895) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-(3,5,5-trimethylhexanoyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(3,5,5-trimethylhexanoyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43161895 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 6-(3,5,5-trimethylhexanoyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(CC(=O)c1ccc2[nH]c(=O)oc2c1)CC(C)(C)C |
| InChI | InChI=1S/C16H21NO3/c1-10(9-16(2,3)4)7-13(18)11-5-6-12-14(8-11)20-15(19)17-12/h5-6,8,10H,7,9H2,1-4H3,(H,17,19) |
| InChIKey | UORFJANCVONBHF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |