C15H21FO — CID 114962701
1-(3-fluorophenyl)-3,5,5-trimethylhexan-1-one (PubChem CID 114962701) has the molecular formula C15H21FO and a molecular weight of 236.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-(3-fluorophenyl)-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 114962701 |
| Molecular Formula | C15H21FO |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(3-fluorophenyl)-3,5,5-trimethylhexan-1-one |
| SMILES | CC(CC(=O)c1cccc(F)c1)CC(C)(C)C |
| InChI | InChI=1S/C15H21FO/c1-11(10-15(2,3)4)8-14(17)12-6-5-7-13(16)9-12/h5-7,9,11H,8,10H2,1-4H3 |
| InChIKey | PTSBMXOUOXZNIA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |