C13H20OS — CID 114975180
3,5,5-trimethyl-1-thiophen-3-ylhexan-1-one (PubChem CID 114975180) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-thiophen-3-ylhexan-1-one.
| Compound Name | 3,5,5-trimethyl-1-thiophen-3-ylhexan-1-one |
|---|---|
| PubChem CID | 114975180 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3,5,5-trimethyl-1-thiophen-3-ylhexan-1-one |
| SMILES | CC(CC(=O)c1ccsc1)CC(C)(C)C |
| InChI | InChI=1S/C13H20OS/c1-10(8-13(2,3)4)7-12(14)11-5-6-15-9-11/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | YNYUYKPLYUTGLP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |