C9H8O5S — CID 6611424
2-(2-oxo-2-thiophen-3-ylethyl)propanedioic acid (PubChem CID 6611424) has the molecular formula C9H8O5S and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-(2-oxo-2-thiophen-3-ylethyl)propanedioic acid.
| Compound Name | 2-(2-oxo-2-thiophen-3-ylethyl)propanedioic acid |
|---|---|
| PubChem CID | 6611424 |
| Molecular Formula | C9H8O5S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(2-oxo-2-thiophen-3-ylethyl)propanedioic acid |
| SMILES | O=C(CC(C(=O)O)C(=O)O)c1ccsc1 |
| InChI | InChI=1S/C9H8O5S/c10-7(5-1-2-15-4-5)3-6(8(11)12)9(13)14/h1-2,4,6H,3H2,(H,11,12)(H,13,14) |
| InChIKey | JWRZXZNPVJGTLM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|