C13H12O2S3 — CID 24864782
2-methylsulfanyl-1,4-di(thiophen-3-yl)butane-1,4-dione (PubChem CID 24864782) has the molecular formula C13H12O2S3 and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-methylsulfanyl-1,4-di(thiophen-3-yl)butane-1,4-dione.
| Compound Name | 2-methylsulfanyl-1,4-di(thiophen-3-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 24864782 |
| Molecular Formula | C13H12O2S3 |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-methylsulfanyl-1,4-di(thiophen-3-yl)butane-1,4-dione |
| SMILES | CSC(CC(=O)c1ccsc1)C(=O)c1ccsc1 |
| InChI | InChI=1S/C13H12O2S3/c1-16-12(13(15)10-3-5-18-8-10)6-11(14)9-2-4-17-7-9/h2-5,7-8,12H,6H2,1H3 |
| InChIKey | GPXUIPOSKCDZCH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |