C8H7F3O2S — CID 125492390
(3R)-4,4,4-trifluoro-3-hydroxy-1-thiophen-3-ylbutan-1-one (PubChem CID 125492390) has the molecular formula C8H7F3O2S and a molecular weight of 224.20 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-hydroxy-1-thiophen-3-ylbutan-1-one.
| Compound Name | (3R)-4,4,4-trifluoro-3-hydroxy-1-thiophen-3-ylbutan-1-one |
|---|---|
| PubChem CID | 125492390 |
| Molecular Formula | C8H7F3O2S |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-hydroxy-1-thiophen-3-ylbutan-1-one |
| SMILES | O=C(C[C@@H](O)C(F)(F)F)c1ccsc1 |
| InChI | InChI=1S/C8H7F3O2S/c9-8(10,11)7(13)3-6(12)5-1-2-14-4-5/h1-2,4,7,13H,3H2/t7-/m1/s1 |
| InChIKey | SOUFDMATEYGUOQ-SSDOTTSWSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |