C11H8F6O5S — CID 162508370
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl thiophene-3-carboxylate (PubChem CID 162508370) has the molecular formula C11H8F6O5S and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl thiophene-3-carboxylate.
| Compound Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl thiophene-3-carboxylate |
|---|---|
| PubChem CID | 162508370 |
| Molecular Formula | C11H8F6O5S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl thiophene-3-carboxylate |
| SMILES | O=C(OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F)c1ccsc1 |
| InChI | InChI=1S/C11H8F6O5S/c12-10(13,14)9(20,11(15,16)17)8(19)22-3-2-21-7(18)6-1-4-23-5-6/h1,4-5,20H,2-3H2 |
| InChIKey | SXXFMRISTHZHOT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|