About 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate
2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate (PubChem CID 86077032) has the molecular formula C10H13BrO2S
and a molecular weight of 277.18 g/mol. Its IUPAC name is 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate |
| PubChem CID | 86077032 |
| Molecular Formula | C10H13BrO2S |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCc1ccsc1 |
| InChI | InChI=1S/C10H13BrO2S/c1-10(2,11)9(12)13-5-3-8-4-6-14-7-8/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | BRUNAWRVVYKQPQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate?
The IUPAC name of 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate (CID 86077032) is 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate.
What is the SMILES notation for 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate?
The canonical SMILES for 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate is CC(C)(Br)C(=O)OCCc1ccsc1.
What is the InChIKey of 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate?
The InChIKey is BRUNAWRVVYKQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO2S/c1-10(2,11)9(12)13-5-3-8-4-6-14-7-8/h4,6-7H,3,5H2,1-2H3.
What are the key properties of 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate?
2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate has a molecular weight of 277.18 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-3-ylethyl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 86077032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).