C13H19NO2S — CID 106489509
methyl 2-(aminomethyl)-2-cyclopropyl-4-thiophen-3-ylbutanoate (PubChem CID 106489509) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-2-cyclopropyl-4-thiophen-3-ylbutanoate.
| Compound Name | methyl 2-(aminomethyl)-2-cyclopropyl-4-thiophen-3-ylbutanoate |
|---|---|
| PubChem CID | 106489509 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 2-(aminomethyl)-2-cyclopropyl-4-thiophen-3-ylbutanoate |
| SMILES | COC(=O)C(CN)(CCc1ccsc1)C1CC1 |
| InChI | InChI=1S/C13H19NO2S/c1-16-12(15)13(9-14,11-2-3-11)6-4-10-5-7-17-8-10/h5,7-8,11H,2-4,6,9,14H2,1H3 |
| InChIKey | XLNDXZFLIIEGOF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |