C9H13NO2S — CID 164676208
methyl (2R)-2-amino-2-methyl-3-thiophen-3-ylpropanoate (PubChem CID 164676208) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-methyl-3-thiophen-3-ylpropanoate.
| Compound Name | methyl (2R)-2-amino-2-methyl-3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 164676208 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | methyl (2R)-2-amino-2-methyl-3-thiophen-3-ylpropanoate |
| SMILES | COC(=O)[C@](C)(N)Cc1ccsc1 |
| InChI | InChI=1S/C9H13NO2S/c1-9(10,8(11)12-2)5-7-3-4-13-6-7/h3-4,6H,5,10H2,1-2H3/t9-/m1/s1 |
| InChIKey | SXTIMHGRLNJGLZ-SECBINFHSA-N |
| XLogP | 1.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |