C10H17ClN2OS — CID 119628292
N-(2-amino-2-methylpropyl)-2-thiophen-3-ylacetamide;hydrochloride (PubChem CID 119628292) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-thiophen-3-ylacetamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-2-thiophen-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119628292 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-thiophen-3-ylacetamide;hydrochloride |
| SMILES | CC(C)(N)CNC(=O)Cc1ccsc1.Cl |
| InChI | InChI=1S/C10H16N2OS.ClH/c1-10(2,11)7-12-9(13)5-8-3-4-14-6-8;/h3-4,6H,5,7,11H2,1-2H3,(H,12,13);1H |
| InChIKey | YIQSKVGKOHXOAP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |