C13H21NO2S — CID 103899658
N-(5-hydroxy-2,2-dimethylpentyl)-2-thiophen-3-ylacetamide (PubChem CID 103899658) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 103899658 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-2-thiophen-3-ylacetamide |
| SMILES | CC(C)(CCCO)CNC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C13H21NO2S/c1-13(2,5-3-6-15)10-14-12(16)8-11-4-7-17-9-11/h4,7,9,15H,3,5-6,8,10H2,1-2H3,(H,14,16) |
| InChIKey | LLVACLQBDQHRNH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |