C12H20N2O2S — CID 111504565
1-(4-hydroxy-2,2-dimethylbutyl)-3-(thiophen-3-ylmethyl)urea (PubChem CID 111504565) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylbutyl)-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylbutyl)-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 111504565 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylbutyl)-3-(thiophen-3-ylmethyl)urea |
| SMILES | CC(C)(CCO)CNC(=O)NCc1ccsc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-12(2,4-5-15)9-14-11(16)13-7-10-3-6-17-8-10/h3,6,8,15H,4-5,7,9H2,1-2H3,(H2,13,14,16) |
| InChIKey | GKUXPMWCBKHFLF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |