C9H10N2OS — CID 130682664
1-prop-2-ynyl-3-(thiophen-3-ylmethyl)urea (PubChem CID 130682664) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 1-prop-2-ynyl-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-prop-2-ynyl-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 130682664 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-prop-2-ynyl-3-(thiophen-3-ylmethyl)urea |
| SMILES | C#CCNC(=O)NCc1ccsc1 |
| InChI | InChI=1S/C9H10N2OS/c1-2-4-10-9(12)11-6-8-3-5-13-7-8/h1,3,5,7H,4,6H2,(H2,10,11,12) |
| InChIKey | HDEQGFWMUWKDHG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|