C10H13N3S — CID 111849920
2-methyl-1-prop-2-ynyl-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111849920) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-methyl-1-prop-2-ynyl-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-prop-2-ynyl-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111849920 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-methyl-1-prop-2-ynyl-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C#CCN/C(=N\C)NCc1ccsc1 |
| InChI | InChI=1S/C10H13N3S/c1-3-5-12-10(11-2)13-7-9-4-6-14-8-9/h1,4,6,8H,5,7H2,2H3,(H2,11,12,13) |
| InChIKey | SHKILKSTYAQHQF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|