C12H14BrN3S2 — CID 111941325
1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111941325) has the molecular formula C12H14BrN3S2 and a molecular weight of 344.30 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111941325 |
| Molecular Formula | C12H14BrN3S2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccsc1)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H14BrN3S2/c1-14-12(15-5-9-2-3-17-7-9)16-6-11-4-10(13)8-18-11/h2-4,7-8H,5-6H2,1H3,(H2,14,15,16) |
| InChIKey | OZGGYFBBAFOGLJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|