C10H13BrF3N3S — CID 109474037
1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474037) has the molecular formula C10H13BrF3N3S and a molecular weight of 344.20 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474037 |
| Molecular Formula | C10H13BrF3N3S |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H13BrF3N3S/c1-15-9(16-3-2-10(12,13)14)17-5-8-4-7(11)6-18-8/h4,6H,2-3,5H2,1H3,(H2,15,16,17) |
| InChIKey | YOCKNFPVTWSDIC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|