C14H20BrN5S — CID 111953185
1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111953185) has the molecular formula C14H20BrN5S and a molecular weight of 370.32 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111953185 |
| Molecular Formula | C14H20BrN5S |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cc(Br)cs1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H20BrN5S/c1-9-13(10(2)20(4)19-9)7-18-14(16-3)17-6-12-5-11(15)8-21-12/h5,8H,6-7H2,1-4H3,(H2,16,17,18) |
| InChIKey | FNJHAZQZFOLKHB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|