C20H29BrIN5 — CID 111952940
1-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952940) has the molecular formula C20H29BrIN5 and a molecular weight of 546.30 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952940 |
| Molecular Formula | C20H29BrIN5 |
| Molecular Weight | 546.30 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 1-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NCC1(c2cccc(Br)c2)CCC1.I |
| InChI | InChI=1S/C20H28BrN5.HI/c1-14-18(15(2)26(4)25-14)12-23-19(22-3)24-13-20(9-6-10-20)16-7-5-8-17(21)11-16;/h5,7-8,11H,6,9-10,12-13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | CBZAYYDNYTVUEE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|