C21H31FIN5O — CID 111639243
1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111639243) has the molecular formula C21H31FIN5O and a molecular weight of 515.42 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111639243 |
| Molecular Formula | C21H31FIN5O |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(CCOC)c1C)NCC1(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C21H30FN5O.HI/c1-15-19(16(2)27(26-15)10-11-28-4)13-24-20(23-3)25-14-21(8-9-21)17-6-5-7-18(22)12-17;/h5-7,12H,8-11,13-14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | QGRBYRMAIMTXOZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|