C21H32ClFIN5O — CID 111569322
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111569322) has the molecular formula C21H32ClFIN5O and a molecular weight of 551.88 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111569322 |
| Molecular Formula | C21H32ClFIN5O |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(CCOC)c1C)NCC(C)(C)c1ccc(F)cc1Cl.I |
| InChI | InChI=1S/C21H31ClFN5O.HI/c1-14-17(15(2)28(27-14)9-10-29-6)12-25-20(24-5)26-13-21(3,4)18-8-7-16(23)11-19(18)22;/h7-8,11H,9-10,12-13H2,1-6H3,(H2,24,25,26);1H |
| InChIKey | NUFRELBEKSMFLX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|