C19H27Cl2N5O — CID 111310422
1-[1-(2,4-dichlorophenyl)ethyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine (PubChem CID 111310422) has the molecular formula C19H27Cl2N5O and a molecular weight of 412.37 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111310422 |
| Molecular Formula | C19H27Cl2N5O |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1c(C)nn(CCOC)c1C)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H27Cl2N5O/c1-12(16-7-6-15(20)10-18(16)21)24-19(22-4)23-11-17-13(2)25-26(14(17)3)8-9-27-5/h6-7,10,12H,8-9,11H2,1-5H3,(H2,22,23,24) |
| InChIKey | DWXCBEIASFTGJJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|