C19H33N7O — CID 111279339
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine (PubChem CID 111279339) has the molecular formula C19H33N7O and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111279339 |
| Molecular Formula | C19H33N7O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1c(C)nn(CCOC)c1C |
| InChI | InChI=1S/C19H33N7O/c1-14-12-15(2)25(23-14)9-7-8-21-19(20-5)22-13-18-16(3)24-26(17(18)4)10-11-27-6/h12H,7-11,13H2,1-6H3,(H2,20,21,22) |
| InChIKey | DAVQUJRWXLKJJF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|