C19H34IN7O — CID 111279338
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111279338) has the molecular formula C19H34IN7O and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111279338 |
| Molecular Formula | C19H34IN7O |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1c(C)nn(CCOC)c1C.I |
| InChI | InChI=1S/C19H33N7O.HI/c1-14-12-15(2)25(23-14)9-7-8-21-19(20-5)22-13-18-16(3)24-26(17(18)4)10-11-27-6;/h12H,7-11,13H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | NTKOKZVUFBKSTN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|